C27H26O7 — CID 46219519
methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate (PubChem CID 46219519) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 46219519 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3ccc(OC)cc3O[C@@]2(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H26O7/c1-31-18-11-9-17(10-12-18)27-23(16-7-5-4-6-8-16)22(25(29)33-3)24(28)26(27,30)20-14-13-19(32-2)15-21(20)34-27/h4-15,22-24,28,30H,1-3H3/t22-,23-,24-,26+,27+/m1/s1 |
| InChIKey | YDGUGHBBJDUJJF-MMDQJTGWSA-N |
| XLogP | 3.13 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |