C18H23NO — CID 46219753
2-[(2,3,4,5,6-pentadeuteriophenyl)-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]methoxy]-N,N-bis(trideuteriomethyl)ethanamine (PubChem CID 46219753) has the molecular formula C18H23NO and a molecular weight of 287.50 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentadeuteriophenyl)-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]methoxy]-N,N-bis(trideuteriomethyl)ethanamine.
| Compound Name | 2-[(2,3,4,5,6-pentadeuteriophenyl)-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]methoxy]-N,N-bis(trideuteriomethyl)ethanamine |
|---|---|
| PubChem CID | 46219753 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 287.50 g/mol |
| Exact Mass | 287.29 |
| IUPAC Name | 2-[(2,3,4,5,6-pentadeuteriophenyl)-[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl]methoxy]-N,N-bis(trideuteriomethyl)ethanamine |
| SMILES | [2H]c1c([2H])c([2H])c(C(OCCN(C([2H])([2H])[2H])C([2H])([2H])[2H])c2c([2H])c([2H])c([2H])c([2H])c2C([2H])([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/i1D3,2D3,3D3,4D,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | QVYRGXJJSLMXQH-JQHAILBLSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |