About N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine
N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine (PubChem CID 46220187) has the molecular formula C19H28N2O2
and a molecular weight of 316.45 g/mol. Its IUPAC name is N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine.
Molecular Properties
| Compound Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine |
| PubChem CID | 46220187 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCc1coc(-c2ccccc2OCC)n1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-6-7-10-15(3)20-13-16-14-23-19(21-16)17-11-8-9-12-18(17)22-5-2/h8-9,11-12,14-15,20H,4-7,10,13H2,1-3H3 |
| InChIKey | VPXVSIWMYXHGAV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
The IUPAC name of N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine (CID 46220187) is N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine.
What is the SMILES notation for N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
The canonical SMILES for N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine is CCCCCC(C)NCc1coc(-c2ccccc2OCC)n1.
What is the InChIKey of N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
The InChIKey is VPXVSIWMYXHGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O2/c1-4-6-7-10-15(3)20-13-16-14-23-19(21-16)17-11-8-9-12-18(17)22-5-2/h8-9,11-12,14-15,20H,4-7,10,13H2,1-3H3.
What are the key properties of N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine has a molecular weight of 316.45 g/mol, XLogP of 4.80, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]heptan-2-amine is sourced from PubChem (CID 46220187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).