C41H75NO2 — CID 46220204
(3R,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine (PubChem CID 46220204) has the molecular formula C41H75NO2 and a molecular weight of 614.06 g/mol. Its IUPAC name is (3R,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine.
| Compound Name | (3R,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
|---|---|
| PubChem CID | 46220204 |
| Molecular Formula | C41H75NO2 |
| Molecular Weight | 614.06 g/mol |
| Exact Mass | 613.58 |
| IUPAC Name | (3R,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@@H]1CN(C)C[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H75NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43-40-38-42(3)39-41(40)44-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,40-41H,4-11,16-17,22-39H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t40-,41-/m1/s1 |
| InChIKey | JEQBUOLEJUHINR-YRDXJVSVSA-N |
| XLogP | 12.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.06 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|