C18H23F2NO — CID 46220458
(9S,10S)-4-(difluoromethoxy)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 46220458) has the molecular formula C18H23F2NO and a molecular weight of 310.40 g/mol. Its IUPAC name is (9S,10S)-4-(difluoromethoxy)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (9S,10S)-4-(difluoromethoxy)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 46220458 |
| Molecular Formula | C18H23F2NO |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (9S,10S)-4-(difluoromethoxy)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | [2H]C([2H])([2H])N1CCC23CCCC[C@@H]2[C@@H]1Cc1ccc(OC(F)F)cc13 |
| InChI | InChI=1S/C18H23F2NO/c1-21-9-8-18-7-3-2-4-14(18)16(21)10-12-5-6-13(11-15(12)18)22-17(19)20/h5-6,11,14,16-17H,2-4,7-10H2,1H3/t14-,16+,18?/m1/s1/i1D3 |
| InChIKey | HXOIJVCEWHZPBJ-AZBKLCKNSA-N |
| XLogP | 3.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |