About 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate
2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate (PubChem CID 46220544) has the molecular formula C26H29N3O2S
and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate |
| PubChem CID | 46220544 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate |
| SMILES | Cc1cccc(CC(NC(=S)NCCOC(=O)c2ccccn2)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C26H29N3O2S/c1-18-8-6-10-21(16-18)17-24(22-11-7-9-19(2)20(22)3)29-26(32)28-14-15-31-25(30)23-12-4-5-13-27-23/h4-13,16,24H,14-15,17H2,1-3H3,(H2,28,29,32) |
| InChIKey | MAPJHSRZHLTKAP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate?
The IUPAC name of 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate (CID 46220544) is 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate.
What is the SMILES notation for 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate?
The canonical SMILES for 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate is Cc1cccc(CC(NC(=S)NCCOC(=O)c2ccccn2)c2cccc(C)c2C)c1.
What is the InChIKey of 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate?
The InChIKey is MAPJHSRZHLTKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N3O2S/c1-18-8-6-10-21(16-18)17-24(22-11-7-9-19(2)20(22)3)29-26(32)28-14-15-31-25(30)23-12-4-5-13-27-23/h4-13,16,24H,14-15,17H2,1-3H3,(H2,28,29,32).
What are the key properties of 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate?
2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate has a molecular weight of 447.60 g/mol, XLogP of 4.61, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,3-dimethylphenyl)-2-(3-methylphenyl)ethyl]carbamothioylamino]ethyl pyridine-2-carboxylate is sourced from PubChem (CID 46220544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).