C26H28O2S — CID 46220728
(2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2,3,4-triphenyloxan-4-ol (PubChem CID 46220728) has the molecular formula C26H28O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is (2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2,3,4-triphenyloxan-4-ol.
| Compound Name | (2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2,3,4-triphenyloxan-4-ol |
|---|---|
| PubChem CID | 46220728 |
| Molecular Formula | C26H28O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2,3,4-triphenyloxan-4-ol |
| SMILES | CCSC[C@@H]1C[C@](O)(c2ccccc2)[C@@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C26H28O2S/c1-2-29-19-23-18-26(27,22-16-10-5-11-17-22)24(20-12-6-3-7-13-20)25(28-23)21-14-8-4-9-15-21/h3-17,23-25,27H,2,18-19H2,1H3/t23-,24-,25-,26-/m0/s1 |
| InChIKey | UPTSZZUOIGQJNC-CQJMVLFOSA-N |
| XLogP | 5.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |