C26H27FO2S — CID 46220730
(2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol (PubChem CID 46220730) has the molecular formula C26H27FO2S and a molecular weight of 422.57 g/mol. Its IUPAC name is (2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol.
| Compound Name | (2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol |
|---|---|
| PubChem CID | 46220730 |
| Molecular Formula | C26H27FO2S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2R,3S,4R,6S)-6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol |
| SMILES | CCSC[C@@H]1C[C@](O)(c2ccccc2)[C@@H](c2ccccc2)[C@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C26H27FO2S/c1-2-30-18-23-17-26(28,21-11-7-4-8-12-21)24(19-9-5-3-6-10-19)25(29-23)20-13-15-22(27)16-14-20/h3-16,23-25,28H,2,17-18H2,1H3/t23-,24-,25-,26-/m0/s1 |
| InChIKey | FSXDGPMVZPSKCM-CQJMVLFOSA-N |
| XLogP | 6.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |