C25H22FNO2S — CID 46220731
[(2S,4R,5S,6R)-6-(4-fluorophenyl)-4-hydroxy-4,5-diphenyloxan-2-yl]methyl thiocyanate (PubChem CID 46220731) has the molecular formula C25H22FNO2S and a molecular weight of 419.52 g/mol. Its IUPAC name is [(2S,4R,5S,6R)-6-(4-fluorophenyl)-4-hydroxy-4,5-diphenyloxan-2-yl]methyl thiocyanate.
| Compound Name | [(2S,4R,5S,6R)-6-(4-fluorophenyl)-4-hydroxy-4,5-diphenyloxan-2-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 46220731 |
| Molecular Formula | C25H22FNO2S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(2S,4R,5S,6R)-6-(4-fluorophenyl)-4-hydroxy-4,5-diphenyloxan-2-yl]methyl thiocyanate |
| SMILES | N#CSC[C@@H]1C[C@](O)(c2ccccc2)[C@@H](c2ccccc2)[C@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C25H22FNO2S/c26-21-13-11-19(12-14-21)24-23(18-7-3-1-4-8-18)25(28,20-9-5-2-6-10-20)15-22(29-24)16-30-17-27/h1-14,22-24,28H,15-16H2/t22-,23-,24-,25-/m0/s1 |
| InChIKey | LKLSPOXUXUIYBW-QORCZRPOSA-N |
| XLogP | 5.54 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|