C25H21F3N6O — CID 46220837
4-amino-2-[6-cyclopropyl-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 46220837) has the molecular formula C25H21F3N6O and a molecular weight of 478.48 g/mol. Its IUPAC name is 4-amino-2-[6-cyclopropyl-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[6-cyclopropyl-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 46220837 |
| Molecular Formula | C25H21F3N6O |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 4-amino-2-[6-cyclopropyl-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-c3nc(Cc4c(F)ccc(F)c4F)n4cc(C5CC5)ccc34)nc(N)c21 |
| InChI | InChI=1S/C25H21F3N6O/c1-25(2)18-21(29)31-23(32-22(18)33-24(25)35)20-16-8-5-12(11-3-4-11)10-34(16)17(30-20)9-13-14(26)6-7-15(27)19(13)28/h5-8,10-11H,3-4,9H2,1-2H3,(H3,29,31,32,33,35) |
| InChIKey | HAGCANIRBUEHBE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|