About 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole
3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole (PubChem CID 46221329) has the molecular formula C7H13N3O2S
and a molecular weight of 203.27 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole |
| PubChem CID | 46221329 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole |
| SMILES | Cc1nc(C)n(CCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C7H13N3O2S/c1-6-8-7(2)10(9-6)4-5-13(3,11)12/h4-5H2,1-3H3 |
| InChIKey | SUIXGPFFWXZCQA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole?
The IUPAC name of 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole (CID 46221329) is 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole.
What is the SMILES notation for 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole?
The canonical SMILES for 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole is Cc1nc(C)n(CCS(C)(=O)=O)n1.
What is the InChIKey of 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole?
The InChIKey is SUIXGPFFWXZCQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2S/c1-6-8-7(2)10(9-6)4-5-13(3,11)12/h4-5H2,1-3H3.
What are the key properties of 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole?
3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole has a molecular weight of 203.27 g/mol, XLogP of -0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-(2-methylsulfonylethyl)-1,2,4-triazole is sourced from PubChem (CID 46221329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).