About 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one
3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one (PubChem CID 46221367) has the molecular formula C23H25NO
and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one.
Molecular Properties
| Compound Name | 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one |
| PubChem CID | 46221367 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one |
| SMILES | Cc1cc(C)cc(C2=C(C3=CCCCC3)N3C=CC=CC3(C)C2=O)c1 |
| InChI | InChI=1S/C23H25NO/c1-16-13-17(2)15-19(14-16)20-21(18-9-5-4-6-10-18)24-12-8-7-11-23(24,3)22(20)25/h7-9,11-15H,4-6,10H2,1-3H3 |
| InChIKey | WOIIHHWRDHFRMF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one?
The IUPAC name of 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one (CID 46221367) is 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one.
What is the SMILES notation for 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one?
The canonical SMILES for 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one is Cc1cc(C)cc(C2=C(C3=CCCCC3)N3C=CC=CC3(C)C2=O)c1.
What is the InChIKey of 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one?
The InChIKey is WOIIHHWRDHFRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO/c1-16-13-17(2)15-19(14-16)20-21(18-9-5-4-6-10-18)24-12-8-7-11-23(24,3)22(20)25/h7-9,11-15H,4-6,10H2,1-3H3.
What are the key properties of 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one?
3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one has a molecular weight of 331.46 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexen-1-yl)-2-(3,5-dimethylphenyl)-8a-methylindolizin-1-one is sourced from PubChem (CID 46221367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).