C24H31NO3Si — CID 46221432
tert-butyl (2R)-6-oxo-3,3-diphenyl-2-propyl-1,3-azasilinane-1-carboxylate (PubChem CID 46221432) has the molecular formula C24H31NO3Si and a molecular weight of 409.60 g/mol. Its IUPAC name is tert-butyl (2R)-6-oxo-3,3-diphenyl-2-propyl-1,3-azasilinane-1-carboxylate.
| Compound Name | tert-butyl (2R)-6-oxo-3,3-diphenyl-2-propyl-1,3-azasilinane-1-carboxylate |
|---|---|
| PubChem CID | 46221432 |
| Molecular Formula | C24H31NO3Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | tert-butyl (2R)-6-oxo-3,3-diphenyl-2-propyl-1,3-azasilinane-1-carboxylate |
| SMILES | CCC[C@@H]1N(C(=O)OC(C)(C)C)C(=O)CC[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO3Si/c1-5-12-22-25(23(27)28-24(2,3)4)21(26)17-18-29(22,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16,22H,5,12,17-18H2,1-4H3/t22-/m1/s1 |
| InChIKey | BKGAGCBVDPPGHM-JOCHJYFZSA-N |
| XLogP | 4.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|