C22H17F3N6O — CID 46221506
4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 46221506) has the molecular formula C22H17F3N6O and a molecular weight of 438.41 g/mol. Its IUPAC name is 4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 46221506 |
| Molecular Formula | C22H17F3N6O |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-n3nc(Cc4c(F)ccc(F)c4F)c4ccccc43)nc(N)c21 |
| InChI | InChI=1S/C22H17F3N6O/c1-22(2)16-18(26)27-21(29-19(16)28-20(22)32)31-15-6-4-3-5-10(15)14(30-31)9-11-12(23)7-8-13(24)17(11)25/h3-8H,9H2,1-2H3,(H3,26,27,28,29,32) |
| InChIKey | NXIBFDKAAHJUKJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|