C23H26O2 — CID 46221672
(3,5-dimethylphenyl)-[(1S,2R)-2-[(E)-3-hydroxy-3-phenylprop-1-enyl]cyclopentyl]methanone (PubChem CID 46221672) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-[(1S,2R)-2-[(E)-3-hydroxy-3-phenylprop-1-enyl]cyclopentyl]methanone.
| Compound Name | (3,5-dimethylphenyl)-[(1S,2R)-2-[(E)-3-hydroxy-3-phenylprop-1-enyl]cyclopentyl]methanone |
|---|---|
| PubChem CID | 46221672 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (3,5-dimethylphenyl)-[(1S,2R)-2-[(E)-3-hydroxy-3-phenylprop-1-enyl]cyclopentyl]methanone |
| SMILES | Cc1cc(C)cc(C(=O)[C@H]2CCC[C@@H]2/C=C/C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H26O2/c1-16-13-17(2)15-20(14-16)23(25)21-10-6-9-18(21)11-12-22(24)19-7-4-3-5-8-19/h3-5,7-8,11-15,18,21-22,24H,6,9-10H2,1-2H3/b12-11+/t18-,21+,22?/m1/s1 |
| InChIKey | UMZJBMZVVBYHDX-SWCAGECESA-N |
| XLogP | 5.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|