C25H18BrClN6O3 — CID 46221987
5-(3-bromophenyl)-1-[(6-chloro-3-pyridinyl)methyl]-7-(furan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-a]pyridine-6,6-dicarbonitrile (PubChem CID 46221987) has the molecular formula C25H18BrClN6O3 and a molecular weight of 565.82 g/mol. Its IUPAC name is 5-(3-bromophenyl)-1-[(6-chloro-3-pyridinyl)methyl]-7-(furan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-a]pyridine-6,6-dicarbonitrile.
| Compound Name | 5-(3-bromophenyl)-1-[(6-chloro-3-pyridinyl)methyl]-7-(furan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-a]pyridine-6,6-dicarbonitrile |
|---|---|
| PubChem CID | 46221987 |
| Molecular Formula | C25H18BrClN6O3 |
| Molecular Weight | 565.82 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | 5-(3-bromophenyl)-1-[(6-chloro-3-pyridinyl)methyl]-7-(furan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-a]pyridine-6,6-dicarbonitrile |
| SMILES | N#CC1(C#N)C(c2ccco2)C([N+](=O)[O-])=C2N(Cc3ccc(Cl)nc3)CCN2C1c1cccc(Br)c1 |
| InChI | InChI=1S/C25H18BrClN6O3/c26-18-4-1-3-17(11-18)23-25(14-28,15-29)21(19-5-2-10-36-19)22(33(34)35)24-31(8-9-32(23)24)13-16-6-7-20(27)30-12-16/h1-7,10-12,21,23H,8-9,13H2 |
| InChIKey | FASCMEHKPGNAID-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 123.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|