About N,N-dimethylmethanamine;trifluoromethanol
N,N-dimethylmethanamine;trifluoromethanol (PubChem CID 46222411) has the molecular formula C4H10F3NO
and a molecular weight of 145.12 g/mol. Its IUPAC name is N,N-dimethylmethanamine;trifluoromethanol.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;trifluoromethanol |
| PubChem CID | 46222411 |
| Molecular Formula | C4H10F3NO |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N,N-dimethylmethanamine;trifluoromethanol |
| SMILES | CN(C)C.OC(F)(F)F |
| InChI | InChI=1S/C3H9N.CHF3O/c1-4(2)3;2-1(3,4)5/h1-3H3;5H |
| InChIKey | ODNNTJOBAORVKU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylmethanamine;trifluoromethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;trifluoromethanol?
The IUPAC name of N,N-dimethylmethanamine;trifluoromethanol (CID 46222411) is N,N-dimethylmethanamine;trifluoromethanol.
What is the SMILES notation for N,N-dimethylmethanamine;trifluoromethanol?
The canonical SMILES for N,N-dimethylmethanamine;trifluoromethanol is CN(C)C.OC(F)(F)F.
What is the InChIKey of N,N-dimethylmethanamine;trifluoromethanol?
The InChIKey is ODNNTJOBAORVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CHF3O/c1-4(2)3;2-1(3,4)5/h1-3H3;5H.
What are the key properties of N,N-dimethylmethanamine;trifluoromethanol?
N,N-dimethylmethanamine;trifluoromethanol has a molecular weight of 145.12 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;trifluoromethanol is sourced from PubChem (CID 46222411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).