C11H19NO — CID 46222745
(2S,5S)-2-but-3-enyl-5-prop-2-enylmorpholine (PubChem CID 46222745) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2S,5S)-2-but-3-enyl-5-prop-2-enylmorpholine.
| Compound Name | (2S,5S)-2-but-3-enyl-5-prop-2-enylmorpholine |
|---|---|
| PubChem CID | 46222745 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2S,5S)-2-but-3-enyl-5-prop-2-enylmorpholine |
| SMILES | C=CCC[C@H]1CN[C@@H](CC=C)CO1 |
| InChI | InChI=1S/C11H19NO/c1-3-5-7-11-8-12-10(6-4-2)9-13-11/h3-4,10-12H,1-2,5-9H2/t10-,11-/m0/s1 |
| InChIKey | FTZDPFAFUPBMBA-QWRGUYRKSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|