About CID 46222758
CID 46222758 (PubChem CID 46222758) has the molecular formula C47H33AgN4O-3
and a molecular weight of 777.68 g/mol.
Molecular Properties
| Compound Name | CID 46222758 |
| PubChem CID | 46222758 |
| Molecular Formula | C47H33AgN4O-3 |
| Molecular Weight | 777.68 g/mol |
| Exact Mass | 776.17 |
| IUPAC Name | — |
| SMILES | CC(C)OC1=Nc2[c-]c1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Ag] |
| InChI | InChI=1S/C47H33N4O.Ag/c1-30(2)52-47-35-29-42(51-47)46(34-21-13-6-14-22-34)41-28-27-40(50-41)45(33-19-11-5-12-20-33)39-26-25-38(49-39)44(32-17-9-4-10-18-32)37-24-23-36(48-37)43(35)31-15-7-3-8-16-31;/h3-28,30H,1-2H3;/q-3;/b43-35+,43-36-,44-37-,44-38-,45-39-,45-40-,46-41-,46-42+; |
| InChIKey | HUNBCLXHFYDQCT-PTVNBGAZSA-N |
| XLogP | 11.32 |
| TPSA | 62.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 777.68 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 46222758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46222758?
The IUPAC name of CID 46222758 (CID 46222758) is not available.
What is the SMILES notation for CID 46222758?
The canonical SMILES for CID 46222758 is CC(C)OC1=Nc2[c-]c1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Ag].
What is the InChIKey of CID 46222758?
The InChIKey is HUNBCLXHFYDQCT-PTVNBGAZSA-N. The full InChI is InChI=1S/C47H33N4O.Ag/c1-30(2)52-47-35-29-42(51-47)46(34-21-13-6-14-22-34)41-28-27-40(50-41)45(33-19-11-5-12-20-33)39-26-25-38(49-39)44(32-17-9-4-10-18-32)37-24-23-36(48-37)43(35)31-15-7-3-8-16-31;/h3-28,30H,1-2H3;/q-3;/b43-35+,43-36-,44-37-,44-38-,45-39-,45-40-,46-41-,46-42+;.
What are the key properties of CID 46222758?
CID 46222758 has a molecular weight of 777.68 g/mol, XLogP of 11.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46222758 is sourced from PubChem (CID 46222758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).