C31H24N2O4S — CID 46222881
(E)-3-[4-[(Z)-[11-(2-methoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl]prop-2-enoic acid (PubChem CID 46222881) has the molecular formula C31H24N2O4S and a molecular weight of 520.61 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-[11-(2-methoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(Z)-[11-(2-methoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 46222881 |
| Molecular Formula | C31H24N2O4S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (E)-3-[4-[(Z)-[11-(2-methoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccccc1C1C2=C(N=c3s/c(=C\c4ccc(/C=C/C(=O)O)cc4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C31H24N2O4S/c1-37-25-9-5-4-8-23(25)29-24-16-15-21-6-2-3-7-22(21)28(24)32-31-33(29)30(36)26(38-31)18-20-12-10-19(11-13-20)14-17-27(34)35/h2-14,17-18,29H,15-16H2,1H3,(H,34,35)/b17-14+,26-18- |
| InChIKey | AAOOPKUWOUCKMS-SVPMCJQISA-N |
| XLogP | 4.43 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|