C20H23ClN6O — CID 46223013
4-amino-2-(5-chloro-3-pentylindazol-1-yl)-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 46223013) has the molecular formula C20H23ClN6O and a molecular weight of 398.90 g/mol. Its IUPAC name is 4-amino-2-(5-chloro-3-pentylindazol-1-yl)-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-(5-chloro-3-pentylindazol-1-yl)-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 46223013 |
| Molecular Formula | C20H23ClN6O |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-amino-2-(5-chloro-3-pentylindazol-1-yl)-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCCc1nn(-c2nc(N)c3c(n2)NC(=O)C3(C)C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H23ClN6O/c1-4-5-6-7-13-12-10-11(21)8-9-14(12)27(26-13)19-23-16(22)15-17(25-19)24-18(28)20(15,2)3/h8-10H,4-7H2,1-3H3,(H3,22,23,24,25,28) |
| InChIKey | DNWSSLVZSMNSBC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|