About 2-ethyl-4-nitrobutanoic acid
2-ethyl-4-nitrobutanoic acid (PubChem CID 46223056) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-ethyl-4-nitrobutanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-4-nitrobutanoic acid |
| PubChem CID | 46223056 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2-ethyl-4-nitrobutanoic acid |
| SMILES | CCC(CC[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-2-5(6(8)9)3-4-7(10)11/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | UNJUZVBTTIHCID-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-nitrobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-nitrobutanoic acid?
The IUPAC name of 2-ethyl-4-nitrobutanoic acid (CID 46223056) is 2-ethyl-4-nitrobutanoic acid.
What is the SMILES notation for 2-ethyl-4-nitrobutanoic acid?
The canonical SMILES for 2-ethyl-4-nitrobutanoic acid is CCC(CC[N+](=O)[O-])C(=O)O.
What is the InChIKey of 2-ethyl-4-nitrobutanoic acid?
The InChIKey is UNJUZVBTTIHCID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c1-2-5(6(8)9)3-4-7(10)11/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-ethyl-4-nitrobutanoic acid?
2-ethyl-4-nitrobutanoic acid has a molecular weight of 161.16 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-nitrobutanoic acid is sourced from PubChem (CID 46223056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).