C32H42N4 — CID 46223107
2-[10-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)decyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46223107) has the molecular formula C32H42N4 and a molecular weight of 482.72 g/mol. Its IUPAC name is 2-[10-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)decyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[10-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)decyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46223107 |
| Molecular Formula | C32H42N4 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 2-[10-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)decyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | c1ccc2c3c([nH]c2c1)CN(CCCCCCCCCCN1CCc2c([nH]c4ccccc24)C1)CC3 |
| InChI | InChI=1S/C32H42N4/c1(3-5-11-19-35-21-17-27-25-13-7-9-15-29(25)33-31(27)23-35)2-4-6-12-20-36-22-18-28-26-14-8-10-16-30(26)34-32(28)24-36/h7-10,13-16,33-34H,1-6,11-12,17-24H2 |
| InChIKey | MPNMJERUXOWHCO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|