C42H63NO5 — CID 4622314
ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate (PubChem CID 4622314) has the molecular formula C42H63NO5 and a molecular weight of 661.97 g/mol. Its IUPAC name is ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate.
| Compound Name | ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
|---|---|
| PubChem CID | 4622314 |
| Molecular Formula | C42H63NO5 |
| Molecular Weight | 661.97 g/mol |
| Exact Mass | 661.47 |
| IUPAC Name | ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
| SMILES | CCOC(=O)N(CC1CCC2CC1C2(C)C)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C42H63NO5/c1-6-48-36(46)43(25-28-12-13-29-22-31(28)37(29,2)3)26-41(47)19-16-34-39(41,5)18-15-33-38(4)17-14-30(44)23-40(38)20-21-42(33,34)32(24-40)35(45)27-10-8-7-9-11-27/h20-21,24,27-31,33-34,44,47H,6-19,22-23,25-26H2,1-5H3 |
| InChIKey | ZWPWJDHLLKNEIJ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.97 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|