C29H30I2N4 — CID 46223336
2-methyl-9-[5-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)pentyl]pyrido[3,4-b]indol-2-ium diiodide (PubChem CID 46223336) has the molecular formula C29H30I2N4 and a molecular weight of 688.40 g/mol. Its IUPAC name is 2-methyl-9-[5-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)pentyl]pyrido[3,4-b]indol-2-ium diiodide.
| Compound Name | 2-methyl-9-[5-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)pentyl]pyrido[3,4-b]indol-2-ium diiodide |
|---|---|
| PubChem CID | 46223336 |
| Molecular Formula | C29H30I2N4 |
| Molecular Weight | 688.40 g/mol |
| Exact Mass | 688.06 |
| IUPAC Name | 2-methyl-9-[5-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)pentyl]pyrido[3,4-b]indol-2-ium diiodide |
| SMILES | C[n+]1ccc2c3ccccc3n(CCCCCn3c4ccccc4c4cc[n+](C)cc43)c2c1.[I-].[I-] |
| InChI | InChI=1S/C29H30N4.2HI/c1-30-18-14-24-22-10-4-6-12-26(22)32(28(24)20-30)16-8-3-9-17-33-27-13-7-5-11-23(27)25-15-19-31(2)21-29(25)33;;/h4-7,10-15,18-21H,3,8-9,16-17H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | GMAVZFBSPGPMAA-UHFFFAOYSA-L |
| XLogP | -0.57 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.40 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|