About [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea
[2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea (PubChem CID 4622356) has the molecular formula C7H9N5O3
and a molecular weight of 211.18 g/mol. Its IUPAC name is [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea.
Molecular Properties
| Compound Name | [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea |
| PubChem CID | 4622356 |
| Molecular Formula | C7H9N5O3 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea |
| SMILES | NC(=O)NNC=Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C7H9N5O3/c8-6(14)11-9-2-4-12-3-1-5(13)10-7(12)15/h1-4,9H,(H3,8,11,14)(H,10,13,15) |
| InChIKey | ZJOZAQOYUVCLAI-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea?
The IUPAC name of [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea (CID 4622356) is [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea.
What is the SMILES notation for [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea?
The canonical SMILES for [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea is NC(=O)NNC=Cn1ccc(=O)[nH]c1=O.
What is the InChIKey of [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea?
The InChIKey is ZJOZAQOYUVCLAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O3/c8-6(14)11-9-2-4-12-3-1-5(13)10-7(12)15/h1-4,9H,(H3,8,11,14)(H,10,13,15).
What are the key properties of [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea?
[2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea has a molecular weight of 211.18 g/mol, XLogP of -1.86, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dioxopyrimidin-1-yl)ethenylamino]urea is sourced from PubChem (CID 4622356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).