C15H22O2S — CID 46223819
(2S,4R,6S)-2-(ethylsulfanylmethyl)-6-methyl-4-phenyloxan-4-ol (PubChem CID 46223819) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is (2S,4R,6S)-2-(ethylsulfanylmethyl)-6-methyl-4-phenyloxan-4-ol.
| Compound Name | (2S,4R,6S)-2-(ethylsulfanylmethyl)-6-methyl-4-phenyloxan-4-ol |
|---|---|
| PubChem CID | 46223819 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2S,4R,6S)-2-(ethylsulfanylmethyl)-6-methyl-4-phenyloxan-4-ol |
| SMILES | CCSC[C@@H]1C[C@@](O)(c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H22O2S/c1-3-18-11-14-10-15(16,9-12(2)17-14)13-7-5-4-6-8-13/h4-8,12,14,16H,3,9-11H2,1-2H3/t12-,14-,15+/m0/s1 |
| InChIKey | CZONFANKYNQMCS-AEGPPILISA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |