C14H17NO2S — CID 46223820
[(2S,4R,6S)-4-hydroxy-6-methyl-4-phenyloxan-2-yl]methyl thiocyanate (PubChem CID 46223820) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is [(2S,4R,6S)-4-hydroxy-6-methyl-4-phenyloxan-2-yl]methyl thiocyanate.
| Compound Name | [(2S,4R,6S)-4-hydroxy-6-methyl-4-phenyloxan-2-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 46223820 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [(2S,4R,6S)-4-hydroxy-6-methyl-4-phenyloxan-2-yl]methyl thiocyanate |
| SMILES | C[C@H]1C[C@](O)(c2ccccc2)C[C@@H](CSC#N)O1 |
| InChI | InChI=1S/C14H17NO2S/c1-11-7-14(16,12-5-3-2-4-6-12)8-13(17-11)9-18-10-15/h2-6,11,13,16H,7-9H2,1H3/t11-,13-,14+/m0/s1 |
| InChIKey | XZRWEDLKBUWJEV-FPMFFAJLSA-N |
| XLogP | 2.66 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|