About O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride
O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride (PubChem CID 46224015) has the molecular formula C9H11ClN4OS
and a molecular weight of 258.73 g/mol. Its IUPAC name is O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride.
Molecular Properties
| Compound Name | O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride |
| PubChem CID | 46224015 |
| Molecular Formula | C9H11ClN4OS |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride |
| SMILES | Cl.NOCc1ccc(-c2nc(N)cs2)cn1 |
| InChI | InChI=1S/C9H10N4OS.ClH/c10-8-5-15-9(13-8)6-1-2-7(4-14-11)12-3-6;/h1-3,5H,4,10-11H2;1H |
| InChIKey | JFUQMAMTXPRBMM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride?
The IUPAC name of O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride (CID 46224015) is O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride.
What is the SMILES notation for O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride?
The canonical SMILES for O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride is Cl.NOCc1ccc(-c2nc(N)cs2)cn1.
What is the InChIKey of O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride?
The InChIKey is JFUQMAMTXPRBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS.ClH/c10-8-5-15-9(13-8)6-1-2-7(4-14-11)12-3-6;/h1-3,5H,4,10-11H2;1H.
What are the key properties of O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride?
O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride has a molecular weight of 258.73 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[5-(4-amino-1,3-thiazol-2-yl)-2-pyridinyl]methyl]hydroxylamine;hydrochloride is sourced from PubChem (CID 46224015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).