C20H24O2S — CID 46224069
(2S,4R,6R)-2-(ethylsulfanylmethyl)-4,6-diphenyloxan-4-ol (PubChem CID 46224069) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is (2S,4R,6R)-2-(ethylsulfanylmethyl)-4,6-diphenyloxan-4-ol.
| Compound Name | (2S,4R,6R)-2-(ethylsulfanylmethyl)-4,6-diphenyloxan-4-ol |
|---|---|
| PubChem CID | 46224069 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2S,4R,6R)-2-(ethylsulfanylmethyl)-4,6-diphenyloxan-4-ol |
| SMILES | CCSC[C@@H]1C[C@@](O)(c2ccccc2)C[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C20H24O2S/c1-2-23-15-18-13-20(21,17-11-7-4-8-12-17)14-19(22-18)16-9-5-3-6-10-16/h3-12,18-19,21H,2,13-15H2,1H3/t18-,19+,20-/m0/s1 |
| InChIKey | BVUBEKFQTZZYPI-ZCNNSNEGSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |