C19H19NO2S — CID 46224070
[(2S,4R,6R)-4-hydroxy-4,6-diphenyloxan-2-yl]methyl thiocyanate (PubChem CID 46224070) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is [(2S,4R,6R)-4-hydroxy-4,6-diphenyloxan-2-yl]methyl thiocyanate.
| Compound Name | [(2S,4R,6R)-4-hydroxy-4,6-diphenyloxan-2-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 46224070 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [(2S,4R,6R)-4-hydroxy-4,6-diphenyloxan-2-yl]methyl thiocyanate |
| SMILES | N#CSC[C@@H]1C[C@@](O)(c2ccccc2)C[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H19NO2S/c20-14-23-13-17-11-19(21,16-9-5-2-6-10-16)12-18(22-17)15-7-3-1-4-8-15/h1-10,17-18,21H,11-13H2/t17-,18+,19-/m0/s1 |
| InChIKey | WIEIKACUUNKAQD-OTWHNJEPSA-N |
| XLogP | 4.01 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|