C20H23FO2S — CID 46224071
(2S,4R,6R)-2-(ethylsulfanylmethyl)-6-(4-fluorophenyl)-4-phenyloxan-4-ol (PubChem CID 46224071) has the molecular formula C20H23FO2S and a molecular weight of 346.47 g/mol. Its IUPAC name is (2S,4R,6R)-2-(ethylsulfanylmethyl)-6-(4-fluorophenyl)-4-phenyloxan-4-ol.
| Compound Name | (2S,4R,6R)-2-(ethylsulfanylmethyl)-6-(4-fluorophenyl)-4-phenyloxan-4-ol |
|---|---|
| PubChem CID | 46224071 |
| Molecular Formula | C20H23FO2S |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2S,4R,6R)-2-(ethylsulfanylmethyl)-6-(4-fluorophenyl)-4-phenyloxan-4-ol |
| SMILES | CCSC[C@@H]1C[C@@](O)(c2ccccc2)C[C@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C20H23FO2S/c1-2-24-14-18-12-20(22,16-6-4-3-5-7-16)13-19(23-18)15-8-10-17(21)11-9-15/h3-11,18-19,22H,2,12-14H2,1H3/t18-,19+,20-/m0/s1 |
| InChIKey | CBOPNSRBBJCEGV-ZCNNSNEGSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |