About [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate
[(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate (PubChem CID 46224072) has the molecular formula C19H18FNO2S
and a molecular weight of 343.42 g/mol. Its IUPAC name is [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate.
Molecular Properties
| Compound Name | [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate |
| PubChem CID | 46224072 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate |
| SMILES | N#CSC[C@@H]1C[C@@](O)(c2ccccc2)C[C@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C19H18FNO2S/c20-16-8-6-14(7-9-16)18-11-19(22,15-4-2-1-3-5-15)10-17(23-18)12-24-13-21/h1-9,17-18,22H,10-12H2/t17-,18+,19-/m0/s1 |
| InChIKey | WAMFUOJWQQDDMD-OTWHNJEPSA-N |
| XLogP | 4.15 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate?
The IUPAC name of [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate (CID 46224072) is [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate.
What is the SMILES notation for [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate?
The canonical SMILES for [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate is N#CSC[C@@H]1C[C@@](O)(c2ccccc2)C[C@H](c2ccc(F)cc2)O1.
What is the InChIKey of [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate?
The InChIKey is WAMFUOJWQQDDMD-OTWHNJEPSA-N. The full InChI is InChI=1S/C19H18FNO2S/c20-16-8-6-14(7-9-16)18-11-19(22,15-4-2-1-3-5-15)10-17(23-18)12-24-13-21/h1-9,17-18,22H,10-12H2/t17-,18+,19-/m0/s1.
What are the key properties of [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate?
[(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate has a molecular weight of 343.42 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxan-2-yl]methyl thiocyanate is sourced from PubChem (CID 46224072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).