C18H23ClN2O2 — CID 46224100
7-chloro-2-hexyl-3a-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]quinazoline-1,5-dione (PubChem CID 46224100) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 7-chloro-2-hexyl-3a-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]quinazoline-1,5-dione.
| Compound Name | 7-chloro-2-hexyl-3a-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]quinazoline-1,5-dione |
|---|---|
| PubChem CID | 46224100 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 7-chloro-2-hexyl-3a-methyl-3,4-dihydro-2H-pyrrolo[1,2-a]quinazoline-1,5-dione |
| SMILES | CCCCCCC1CC2(C)NC(=O)c3cc(Cl)ccc3N2C1=O |
| InChI | InChI=1S/C18H23ClN2O2/c1-3-4-5-6-7-12-11-18(2)20-16(22)14-10-13(19)8-9-15(14)21(18)17(12)23/h8-10,12H,3-7,11H2,1-2H3,(H,20,22) |
| InChIKey | LALLCGZLGIAPMJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|