About [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol
[2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol (PubChem CID 46224246) has the molecular formula C14H9BrCl2N2O
and a molecular weight of 372.05 g/mol. Its IUPAC name is [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol |
| PubChem CID | 46224246 |
| Molecular Formula | C14H9BrCl2N2O |
| Molecular Weight | 372.05 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol |
| SMILES | OCc1c(-c2ccc(Br)cc2)nc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C14H9BrCl2N2O/c15-9-3-1-8(2-4-9)13-12(7-20)19-6-10(16)5-11(17)14(19)18-13/h1-6,20H,7H2 |
| InChIKey | QIPFYIIANPDLHK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.05 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol?
The IUPAC name of [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol (CID 46224246) is [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol.
What is the SMILES notation for [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol?
The canonical SMILES for [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol is OCc1c(-c2ccc(Br)cc2)nc2c(Cl)cc(Cl)cn12.
What is the InChIKey of [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol?
The InChIKey is QIPFYIIANPDLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrCl2N2O/c15-9-3-1-8(2-4-9)13-12(7-20)19-6-10(16)5-11(17)14(19)18-13/h1-6,20H,7H2.
What are the key properties of [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol?
[2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol has a molecular weight of 372.05 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]methanol is sourced from PubChem (CID 46224246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).