C19H30N2O3S — CID 46224634
N-[3-(cyclopentylsulfamoyl)-4,5-dimethylphenyl]-2,2-dimethylbutanamide (PubChem CID 46224634) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[3-(cyclopentylsulfamoyl)-4,5-dimethylphenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[3-(cyclopentylsulfamoyl)-4,5-dimethylphenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 46224634 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[3-(cyclopentylsulfamoyl)-4,5-dimethylphenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(C)c(C)c(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C19H30N2O3S/c1-6-19(4,5)18(22)20-16-11-13(2)14(3)17(12-16)25(23,24)21-15-9-7-8-10-15/h11-12,15,21H,6-10H2,1-5H3,(H,20,22) |
| InChIKey | CNDQSCXSSCTHKH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |