About N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide
N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide (PubChem CID 46224662) has the molecular formula C19H30N2O3S
and a molecular weight of 366.53 g/mol. Its IUPAC name is N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide |
| PubChem CID | 46224662 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(C)c(C)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H30N2O3S/c1-6-19(4,5)18(22)20-16-12-14(2)15(3)17(13-16)25(23,24)21-10-8-7-9-11-21/h12-13H,6-11H2,1-5H3,(H,20,22) |
| InChIKey | GRVIRAHUADMZRK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide?
The IUPAC name of N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide (CID 46224662) is N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide.
What is the SMILES notation for N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide?
The canonical SMILES for N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide is CCC(C)(C)C(=O)Nc1cc(C)c(C)c(S(=O)(=O)N2CCCCC2)c1.
What is the InChIKey of N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide?
The InChIKey is GRVIRAHUADMZRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O3S/c1-6-19(4,5)18(22)20-16-12-14(2)15(3)17(13-16)25(23,24)21-10-8-7-9-11-21/h12-13H,6-11H2,1-5H3,(H,20,22).
What are the key properties of N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide?
N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide has a molecular weight of 366.53 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethyl-5-piperidin-1-ylsulfonylphenyl)-2,2-dimethylbutanamide is sourced from PubChem (CID 46224662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).