About 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine
7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 46224696) has the molecular formula C21H14N6S
and a molecular weight of 382.45 g/mol. Its IUPAC name is 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| PubChem CID | 46224696 |
| Molecular Formula | C21H14N6S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2[nH]cc(-c3cc(-c4cc5ccccc5s4)c4[nH]ncc4c3)c2n1 |
| InChI | InChI=1S/C21H14N6S/c22-21-24-10-16-20(26-21)15(9-23-16)12-5-13-8-25-27-19(13)14(6-12)18-7-11-3-1-2-4-17(11)28-18/h1-10,23H,(H,25,27)(H2,22,24,26) |
| InChIKey | UFEDSAVXRGQCQV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The IUPAC name of 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine (CID 46224696) is 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine is Nc1ncc2[nH]cc(-c3cc(-c4cc5ccccc5s4)c4[nH]ncc4c3)c2n1.
What is the InChIKey of 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The InChIKey is UFEDSAVXRGQCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N6S/c22-21-24-10-16-20(26-21)15(9-23-16)12-5-13-8-25-27-19(13)14(6-12)18-7-11-3-1-2-4-17(11)28-18/h1-10,23H,(H,25,27)(H2,22,24,26).
What are the key properties of 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine has a molecular weight of 382.45 g/mol, XLogP of 4.97, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-5H-pyrrolo[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 46224696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).