C21H22ClN3O4S — CID 46224756
N-[3-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropyl]methanesulfonamide (PubChem CID 46224756) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is N-[3-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropyl]methanesulfonamide.
| Compound Name | N-[3-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 46224756 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[3-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxopropyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(O)c1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-30(28,29)23-9-7-19(27)25-10-8-16-17-12-14(22)5-6-18(17)24-20(16)21(25)13-3-2-4-15(26)11-13/h2-6,11-12,21,23-24,26H,7-10H2,1H3 |
| InChIKey | FCDXJADWFQJHHH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|