C22H24ClN3O2 — CID 46224757
(2S)-2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-methylbutan-1-one (PubChem CID 46224757) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is (2S)-2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-methylbutan-1-one.
| Compound Name | (2S)-2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 46224757 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (2S)-2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-methylbutan-1-one |
| SMILES | CC(C)[C@H](N)C(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(O)c1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-12(2)19(24)22(28)26-9-8-16-17-11-14(23)6-7-18(17)25-20(16)21(26)13-4-3-5-15(27)10-13/h3-7,10-12,19,21,25,27H,8-9,24H2,1-2H3/t19-,21?/m0/s1 |
| InChIKey | FRXODPNPSMUHSR-ZQRQZVKFSA-N |
| XLogP | 3.98 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|