About 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine
4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine (PubChem CID 46224771) has the molecular formula C18H13NOS2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine.
Molecular Properties
| Compound Name | 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine |
| PubChem CID | 46224771 |
| Molecular Formula | C18H13NOS2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine |
| SMILES | Cc1ccc(-c2cc(-c3ccsc3)nc(-c3ccsc3)c2)o1 |
| InChI | InChI=1S/C18H13NOS2/c1-12-2-3-18(20-12)15-8-16(13-4-6-21-10-13)19-17(9-15)14-5-7-22-11-14/h2-11H,1H3 |
| InChIKey | ZSNJAKMDQSKZNF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine?
The IUPAC name of 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine (CID 46224771) is 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine.
What is the SMILES notation for 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine?
The canonical SMILES for 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine is Cc1ccc(-c2cc(-c3ccsc3)nc(-c3ccsc3)c2)o1.
What is the InChIKey of 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine?
The InChIKey is ZSNJAKMDQSKZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NOS2/c1-12-2-3-18(20-12)15-8-16(13-4-6-21-10-13)19-17(9-15)14-5-7-22-11-14/h2-11H,1H3.
What are the key properties of 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine?
4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine has a molecular weight of 323.44 g/mol, XLogP of 6.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methylfuran-2-yl)-2,6-di(thiophen-3-yl)pyridine is sourced from PubChem (CID 46224771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).