C20H12F4N4O — CID 46224805
4-[1-(1,3-diazinan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile (PubChem CID 46224805) has the molecular formula C20H12F4N4O and a molecular weight of 400.34 g/mol. Its IUPAC name is 4-[1-(1,3-diazinan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile.
| Compound Name | 4-[1-(1,3-diazinan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 46224805 |
| Molecular Formula | C20H12F4N4O |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-[1-(1,3-diazinan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(F)c(C(C(=O)c2ccc(F)cc2)=C2NCCCN2)c(C#N)c1F |
| InChI | InChI=1S/C20H12F4N4O/c21-11-4-2-10(3-5-11)19(29)15(20-27-6-1-7-28-20)14-12(8-25)16(22)13(9-26)17(23)18(14)24/h2-5,27-28H,1,6-7H2 |
| InChIKey | AULQPENVRYUWSH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|