C18H17ClF6N2 — CID 46224824
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N'-(4-chlorophenyl)propane-1,3-diamine (PubChem CID 46224824) has the molecular formula C18H17ClF6N2 and a molecular weight of 410.79 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N'-(4-chlorophenyl)propane-1,3-diamine.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N'-(4-chlorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 46224824 |
| Molecular Formula | C18H17ClF6N2 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N'-(4-chlorophenyl)propane-1,3-diamine |
| SMILES | FC(F)(F)c1cc(CNCCCNc2ccc(Cl)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF6N2/c19-15-2-4-16(5-3-15)27-7-1-6-26-11-12-8-13(17(20,21)22)10-14(9-12)18(23,24)25/h2-5,8-10,26-27H,1,6-7,11H2 |
| InChIKey | WTSHNZGKOWONII-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|