C20H26ClN3O — CID 46224838
3-amino-1-(6-chloro-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one (PubChem CID 46224838) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 3-amino-1-(6-chloro-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one.
| Compound Name | 3-amino-1-(6-chloro-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 46224838 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-amino-1-(6-chloro-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
| SMILES | NCCC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1C1CCCCC1 |
| InChI | InChI=1S/C20H26ClN3O/c21-14-6-7-17-16(12-14)15-9-11-24(18(25)8-10-22)20(19(15)23-17)13-4-2-1-3-5-13/h6-7,12-13,20,23H,1-5,8-11,22H2 |
| InChIKey | MUQOWMZMUVGSPN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|