C21H14F4N4O — CID 46224841
4-[1-(1,3-diazepan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile (PubChem CID 46224841) has the molecular formula C21H14F4N4O and a molecular weight of 414.36 g/mol. Its IUPAC name is 4-[1-(1,3-diazepan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile.
| Compound Name | 4-[1-(1,3-diazepan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 46224841 |
| Molecular Formula | C21H14F4N4O |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-[1-(1,3-diazepan-2-ylidene)-2-(4-fluorophenyl)-2-oxoethyl]-2,5,6-trifluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(F)c(C(C(=O)c2ccc(F)cc2)=C2NCCCCN2)c(C#N)c1F |
| InChI | InChI=1S/C21H14F4N4O/c22-12-5-3-11(4-6-12)20(30)16(21-28-7-1-2-8-29-21)15-13(9-26)17(23)14(10-27)18(24)19(15)25/h3-6,28-29H,1-2,7-8H2 |
| InChIKey | DRJJKECIOLDKPJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|