C21H18N4O2S — CID 46224876
N-[4-(8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl)phenyl]methanesulfonamide (PubChem CID 46224876) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[4-(8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 46224876 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[4-(8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C2Nc3ccccc3-c3ccnc4[nH]cc2c34)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c1-28(26,27)25-14-8-6-13(7-9-14)20-17-12-23-21-19(17)16(10-11-22-21)15-4-2-3-5-18(15)24-20/h2-12,20,24-25H,1H3,(H,22,23) |
| InChIKey | YBGNBXBXNCHMCA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |