About 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine
4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine (PubChem CID 46224889) has the molecular formula C19H15NOS2
and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine.
Molecular Properties
| Compound Name | 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine |
| PubChem CID | 46224889 |
| Molecular Formula | C19H15NOS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine |
| SMILES | Cc1ccsc1-c1cc(-c2ccoc2)cc(-c2sccc2C)n1 |
| InChI | InChI=1S/C19H15NOS2/c1-12-4-7-22-18(12)16-9-15(14-3-6-21-11-14)10-17(20-16)19-13(2)5-8-23-19/h3-11H,1-2H3 |
| InChIKey | BWGSMMQFBNWNBK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine?
The IUPAC name of 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine (CID 46224889) is 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine.
What is the SMILES notation for 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine?
The canonical SMILES for 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine is Cc1ccsc1-c1cc(-c2ccoc2)cc(-c2sccc2C)n1.
What is the InChIKey of 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine?
The InChIKey is BWGSMMQFBNWNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NOS2/c1-12-4-7-22-18(12)16-9-15(14-3-6-21-11-14)10-17(20-16)19-13(2)5-8-23-19/h3-11H,1-2H3.
What are the key properties of 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine?
4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine has a molecular weight of 337.47 g/mol, XLogP of 6.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-3-yl)-2,6-bis(3-methylthiophen-2-yl)pyridine is sourced from PubChem (CID 46224889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).