C20H12N4O — CID 46224970
10,18,20,22-tetrazahexacyclo[15.6.1.02,10.03,8.011,16.021,24]tetracosa-1(23),3,5,7,11,13,15,17(24),18,20-decaen-9-one (PubChem CID 46224970) has the molecular formula C20H12N4O and a molecular weight of 324.34 g/mol. Its IUPAC name is 10,18,20,22-tetrazahexacyclo[15.6.1.02,10.03,8.011,16.021,24]tetracosa-1(23),3,5,7,11,13,15,17(24),18,20-decaen-9-one.
| Compound Name | 10,18,20,22-tetrazahexacyclo[15.6.1.02,10.03,8.011,16.021,24]tetracosa-1(23),3,5,7,11,13,15,17(24),18,20-decaen-9-one |
|---|---|
| PubChem CID | 46224970 |
| Molecular Formula | C20H12N4O |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 10,18,20,22-tetrazahexacyclo[15.6.1.02,10.03,8.011,16.021,24]tetracosa-1(23),3,5,7,11,13,15,17(24),18,20-decaen-9-one |
| SMILES | O=C1c2ccccc2C2c3c[nH]c4ncnc(c34)-c3ccccc3N12 |
| InChI | InChI=1S/C20H12N4O/c25-20-12-6-2-1-5-11(12)18-14-9-21-19-16(14)17(22-10-23-19)13-7-3-4-8-15(13)24(18)20/h1-10,18H,(H,21,22,23) |
| InChIKey | VZPSNTAJTYQORF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |