C26H44ClN5O4S — CID 46225012
(3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(sulfamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 46225012) has the molecular formula C26H44ClN5O4S and a molecular weight of 558.19 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(sulfamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(sulfamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46225012 |
| Molecular Formula | C26H44ClN5O4S |
| Molecular Weight | 558.19 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(sulfamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@](O)(CCCNS(N)(=O)=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C26H44ClN5O4S/c1-29-18-24(16-20-8-3-2-4-9-20)31-25(33)32-15-6-11-22(19-32)26(34,13-7-14-30-37(28,35)36)21-10-5-12-23(27)17-21/h5,10,12,17,20,22,24,29-30,34H,2-4,6-9,11,13-16,18-19H2,1H3,(H,31,33)(H2,28,35,36)/t22-,24+,26-/m1/s1 |
| InChIKey | LHMKYOPUANARSY-KTIWRFAQSA-N |
| XLogP | 3.08 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|