C28H46ClN5O3 — CID 46225036
(3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methylcarbamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 46225036) has the molecular formula C28H46ClN5O3 and a molecular weight of 536.16 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methylcarbamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methylcarbamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46225036 |
| Molecular Formula | C28H46ClN5O3 |
| Molecular Weight | 536.16 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | (3R)-3-[(1S)-1-(3-chlorophenyl)-1-hydroxy-4-(methylcarbamoylamino)butyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@](O)(CCCNC(=O)NC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C28H46ClN5O3/c1-30-19-25(17-21-9-4-3-5-10-21)33-27(36)34-16-7-12-23(20-34)28(37,14-8-15-32-26(35)31-2)22-11-6-13-24(29)18-22/h6,11,13,18,21,23,25,30,37H,3-5,7-10,12,14-17,19-20H2,1-2H3,(H,33,36)(H2,31,32,35)/t23-,25+,28-/m1/s1 |
| InChIKey | KXQVLZNOBJEAOL-FKIGELJASA-N |
| XLogP | 4.22 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|